C29H32I2N2O2 — CID 46735421
4-[2-[4-[2-methoxy-5-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenoxy]phenyl]ethyl]-1-methylpyridin-1-ium diiodide (PubChem CID 46735421) has the molecular formula C29H32I2N2O2 and a molecular weight of 694.40 g/mol. Its IUPAC name is 4-[2-[4-[2-methoxy-5-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenoxy]phenyl]ethyl]-1-methylpyridin-1-ium diiodide.
| Compound Name | 4-[2-[4-[2-methoxy-5-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenoxy]phenyl]ethyl]-1-methylpyridin-1-ium diiodide |
|---|---|
| PubChem CID | 46735421 |
| Molecular Formula | C29H32I2N2O2 |
| Molecular Weight | 694.40 g/mol |
| Exact Mass | 694.06 |
| IUPAC Name | 4-[2-[4-[2-methoxy-5-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenoxy]phenyl]ethyl]-1-methylpyridin-1-ium diiodide |
| SMILES | COc1ccc(CCc2cc[n+](C)cc2)cc1Oc1ccc(CCc2cc[n+](C)cc2)cc1.[I-].[I-] |
| InChI | InChI=1S/C29H32N2O2.2HI/c1-30-18-14-24(15-19-30)5-4-23-8-11-27(12-9-23)33-29-22-26(10-13-28(29)32-3)7-6-25-16-20-31(2)21-17-25;;/h8-22H,4-7H2,1-3H3;2*1H/q+2;;/p-2 |
| InChIKey | SPRQUPWPPAQLTJ-UHFFFAOYSA-L |
| XLogP | -1.29 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.40 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|