C12H18ClNO — CID 46735722
3-(3,5-dimethylphenoxy)pyrrolidine;hydrochloride (PubChem CID 46735722) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is 3-(3,5-dimethylphenoxy)pyrrolidine;hydrochloride.
| Compound Name | 3-(3,5-dimethylphenoxy)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 46735722 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-(3,5-dimethylphenoxy)pyrrolidine;hydrochloride |
| SMILES | Cc1cc(C)cc(OC2CCNC2)c1.Cl |
| InChI | InChI=1S/C12H17NO.ClH/c1-9-5-10(2)7-12(6-9)14-11-3-4-13-8-11;/h5-7,11,13H,3-4,8H2,1-2H3;1H |
| InChIKey | KPIZIOVTNKOHPX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |