C12H17Cl2N3 — CID 46735889
N'-(2-methylquinolin-4-yl)ethane-1,2-diamine;dihydrochloride (PubChem CID 46735889) has the molecular formula C12H17Cl2N3 and a molecular weight of 274.20 g/mol. Its IUPAC name is N'-(2-methylquinolin-4-yl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | N'-(2-methylquinolin-4-yl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 46735889 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N'-(2-methylquinolin-4-yl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cc1cc(NCCN)c2ccccc2n1.Cl.Cl |
| InChI | InChI=1S/C12H15N3.2ClH/c1-9-8-12(14-7-6-13)10-4-2-3-5-11(10)15-9;;/h2-5,8H,6-7,13H2,1H3,(H,14,15);2*1H |
| InChIKey | JNDRTNUFJKNFQV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |