C16H19N3O10 — CID 46735935
1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid (PubChem CID 46735935) has the molecular formula C16H19N3O10 and a molecular weight of 413.34 g/mol. Its IUPAC name is 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid.
| Compound Name | 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 46735935 |
| Molecular Formula | C16H19N3O10 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid |
| SMILES | Nc1ccc(OCC(O)Cn2ccnc2)cc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H15N3O2.2C2H2O4/c13-10-1-3-12(4-2-10)17-8-11(16)7-15-6-5-14-9-15;2*3-1(4)2(5)6/h1-6,9,11,16H,7-8,13H2;2*(H,3,4)(H,5,6) |
| InChIKey | VCEOBQUQCLHZJF-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 222.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|