1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid

C16H19N3O10 — CID 46735935

IUPAC1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid
SMILESNc1ccc(OCC(O)Cn2ccnc2)cc1.O=C(O)C(=O)O.O=C(O)C(=O)O
InChIInChI=1S/C12H15N3O2.2C2H2O4/c13-10-1-3-12(4-2-10)17-8-11(16)7-15-6-5-14-9-15;2*3-1(4)2(5)6/h1-6,9,11,16H,7-8,13H2;2*(H,3,4)(H,5,6)
InChIKeyVCEOBQUQCLHZJF-UHFFFAOYSA-N
MW413.34 g/mol
LogP-0.78
Rot. Bonds5

About 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid

1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid (PubChem CID 46735935) has the molecular formula C16H19N3O10 and a molecular weight of 413.34 g/mol. Its IUPAC name is 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid.

Molecular Properties

Compound Name1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid
PubChem CID46735935
Molecular FormulaC16H19N3O10
Molecular Weight413.34 g/mol
Exact Mass413.11
IUPAC Name1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid
SMILESNc1ccc(OCC(O)Cn2ccnc2)cc1.O=C(O)C(=O)O.O=C(O)C(=O)O
InChIInChI=1S/C12H15N3O2.2C2H2O4/c13-10-1-3-12(4-2-10)17-8-11(16)7-15-6-5-14-9-15;2*3-1(4)2(5)6/h1-6,9,11,16H,7-8,13H2;2*(H,3,4)(H,5,6)
InChIKeyVCEOBQUQCLHZJF-UHFFFAOYSA-N
XLogP-0.78
TPSA222.50 Ų
H-Bond Donors6
H-Bond Acceptors9
Rotatable Bonds5
Heavy Atoms29
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500413.34
LogP ≤ 5-0.78
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid?
The IUPAC name of 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid (CID 46735935) is 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid.
What is the SMILES notation for 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid?
The canonical SMILES for 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid is Nc1ccc(OCC(O)Cn2ccnc2)cc1.O=C(O)C(=O)O.O=C(O)C(=O)O.
What is the InChIKey of 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid?
The InChIKey is VCEOBQUQCLHZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2.2C2H2O4/c13-10-1-3-12(4-2-10)17-8-11(16)7-15-6-5-14-9-15;2*3-1(4)2(5)6/h1-6,9,11,16H,7-8,13H2;2*(H,3,4)(H,5,6).
What are the key properties of 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid?
1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid has a molecular weight of 413.34 g/mol, XLogP of -0.78, 5 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminophenoxy)-3-imidazol-1-ylpropan-2-ol;oxalic acid is sourced from PubChem (CID 46735935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).