C12H18ClNO — CID 46736559
2,2,7-trimethyl-3,4-dihydrochromen-4-amine;hydrochloride (PubChem CID 46736559) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is 2,2,7-trimethyl-3,4-dihydrochromen-4-amine;hydrochloride.
| Compound Name | 2,2,7-trimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
|---|---|
| PubChem CID | 46736559 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2,2,7-trimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| SMILES | Cc1ccc2c(c1)OC(C)(C)CC2N.Cl |
| InChI | InChI=1S/C12H17NO.ClH/c1-8-4-5-9-10(13)7-12(2,3)14-11(9)6-8;/h4-6,10H,7,13H2,1-3H3;1H |
| InChIKey | LKWTZLIPPKWQEF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |