About (4-ethyl-3,5-dimethylphenyl)boronic acid
(4-ethyl-3,5-dimethylphenyl)boronic acid (PubChem CID 46736813) has the molecular formula C10H15BO2
and a molecular weight of 178.04 g/mol. Its IUPAC name is (4-ethyl-3,5-dimethylphenyl)boronic acid.
Molecular Properties
| Compound Name | (4-ethyl-3,5-dimethylphenyl)boronic acid |
| PubChem CID | 46736813 |
| Molecular Formula | C10H15BO2 |
| Molecular Weight | 178.04 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (4-ethyl-3,5-dimethylphenyl)boronic acid |
| SMILES | CCc1c(C)cc(B(O)O)cc1C |
| InChI | InChI=1S/C10H15BO2/c1-4-10-7(2)5-9(11(12)13)6-8(10)3/h5-6,12-13H,4H2,1-3H3 |
| InChIKey | JLFFMHZXQGFWCG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.04 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-ethyl-3,5-dimethylphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-3,5-dimethylphenyl)boronic acid?
The IUPAC name of (4-ethyl-3,5-dimethylphenyl)boronic acid (CID 46736813) is (4-ethyl-3,5-dimethylphenyl)boronic acid.
What is the SMILES notation for (4-ethyl-3,5-dimethylphenyl)boronic acid?
The canonical SMILES for (4-ethyl-3,5-dimethylphenyl)boronic acid is CCc1c(C)cc(B(O)O)cc1C.
What is the InChIKey of (4-ethyl-3,5-dimethylphenyl)boronic acid?
The InChIKey is JLFFMHZXQGFWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BO2/c1-4-10-7(2)5-9(11(12)13)6-8(10)3/h5-6,12-13H,4H2,1-3H3.
What are the key properties of (4-ethyl-3,5-dimethylphenyl)boronic acid?
(4-ethyl-3,5-dimethylphenyl)boronic acid has a molecular weight of 178.04 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-3,5-dimethylphenyl)boronic acid is sourced from PubChem (CID 46736813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).