About [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride
[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride (PubChem CID 46736906) has the molecular formula C5H10ClN3O2
and a molecular weight of 179.61 g/mol. Its IUPAC name is [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride |
| PubChem CID | 46736906 |
| Molecular Formula | C5H10ClN3O2 |
| Molecular Weight | 179.61 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride |
| SMILES | COCc1noc(CN)n1.Cl |
| InChI | InChI=1S/C5H9N3O2.ClH/c1-9-3-4-7-5(2-6)10-8-4;/h2-3,6H2,1H3;1H |
| InChIKey | CXDCHHRHXFOUDH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.61 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride?
The IUPAC name of [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride (CID 46736906) is [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride.
What is the SMILES notation for [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride?
The canonical SMILES for [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride is COCc1noc(CN)n1.Cl.
What is the InChIKey of [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride?
The InChIKey is CXDCHHRHXFOUDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O2.ClH/c1-9-3-4-7-5(2-6)10-8-4;/h2-3,6H2,1H3;1H.
What are the key properties of [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride?
[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride has a molecular weight of 179.61 g/mol, XLogP of 0.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride is sourced from PubChem (CID 46736906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).