About [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride
[(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride (PubChem CID 46736993) has the molecular formula C11H15Cl2NO
and a molecular weight of 248.15 g/mol. Its IUPAC name is [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride |
| PubChem CID | 46736993 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride |
| SMILES | Cl.OC[C@@H]1CNC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO.ClH/c12-10-3-1-8(2-4-10)11-6-13-5-9(11)7-14;/h1-4,9,11,13-14H,5-7H2;1H/t9-,11-;/m0./s1 |
| InChIKey | MAQCKMCMVDAXMR-ROLPUNSJSA-N |
| XLogP | 2.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride?
The IUPAC name of [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride (CID 46736993) is [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride.
What is the SMILES notation for [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride?
The canonical SMILES for [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride is Cl.OC[C@@H]1CNC[C@H]1c1ccc(Cl)cc1.
What is the InChIKey of [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride?
The InChIKey is MAQCKMCMVDAXMR-ROLPUNSJSA-N. The full InChI is InChI=1S/C11H14ClNO.ClH/c12-10-3-1-8(2-4-10)11-6-13-5-9(11)7-14;/h1-4,9,11,13-14H,5-7H2;1H/t9-,11-;/m0./s1.
What are the key properties of [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride?
[(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride has a molecular weight of 248.15 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride is sourced from PubChem (CID 46736993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).