About 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride
2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (PubChem CID 46737066) has the molecular formula C8H10ClN5O
and a molecular weight of 227.66 g/mol. Its IUPAC name is 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| PubChem CID | 46737066 |
| Molecular Formula | C8H10ClN5O |
| Molecular Weight | 227.66 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1nc(-c2cnccn2)no1 |
| InChI | InChI=1S/C8H9N5O.ClH/c9-2-1-7-12-8(13-14-7)6-5-10-3-4-11-6;/h3-5H,1-2,9H2;1H |
| InChIKey | GZCZLIHJFNPESX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.66 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (CID 46737066) is 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride is Cl.NCCc1nc(-c2cnccn2)no1.
What is the InChIKey of 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The InChIKey is GZCZLIHJFNPESX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O.ClH/c9-2-1-7-12-8(13-14-7)6-5-10-3-4-11-6;/h3-5H,1-2,9H2;1H.
What are the key properties of 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride has a molecular weight of 227.66 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride is sourced from PubChem (CID 46737066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).