About 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride
5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride (PubChem CID 46737146) has the molecular formula C6H10ClN3O
and a molecular weight of 175.62 g/mol. Its IUPAC name is 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride.
Molecular Properties
| Compound Name | 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride |
| PubChem CID | 46737146 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cc1noc(C2CNC2)n1.Cl |
| InChI | InChI=1S/C6H9N3O.ClH/c1-4-8-6(10-9-4)5-2-7-3-5;/h5,7H,2-3H2,1H3;1H |
| InChIKey | XSXSNQPOWQLACE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride?
The IUPAC name of 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride (CID 46737146) is 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride.
What is the SMILES notation for 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride?
The canonical SMILES for 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride is Cc1noc(C2CNC2)n1.Cl.
What is the InChIKey of 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride?
The InChIKey is XSXSNQPOWQLACE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O.ClH/c1-4-8-6(10-9-4)5-2-7-3-5;/h5,7H,2-3H2,1H3;1H.
What are the key properties of 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride?
5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride has a molecular weight of 175.62 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(azetidin-3-yl)-3-methyl-1,2,4-oxadiazole;hydrochloride is sourced from PubChem (CID 46737146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).