About (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride
(3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride (PubChem CID 46738056) has the molecular formula C12H14ClF2NO
and a molecular weight of 261.70 g/mol. Its IUPAC name is (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride.
Molecular Properties
| Compound Name | (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| PubChem CID | 46738056 |
| Molecular Formula | C12H14ClF2NO |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(F)c(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C12H13F2NO.ClH/c13-10-2-1-9(7-11(10)14)12(16)8-3-5-15-6-4-8;/h1-2,7-8,15H,3-6H2;1H |
| InChIKey | IPNJNEPAHFKDLB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride?
The IUPAC name of (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride (CID 46738056) is (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride.
What is the SMILES notation for (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride?
The canonical SMILES for (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride is Cl.O=C(c1ccc(F)c(F)c1)C1CCNCC1.
What is the InChIKey of (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride?
The InChIKey is IPNJNEPAHFKDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO.ClH/c13-10-2-1-9(7-11(10)14)12(16)8-3-5-15-6-4-8;/h1-2,7-8,15H,3-6H2;1H.
What are the key properties of (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride?
(3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride has a molecular weight of 261.70 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride is sourced from PubChem (CID 46738056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).