C8H4BrF5 — CID 46738078
1-bromo-2-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 46738078) has the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. Its IUPAC name is 1-bromo-2-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-bromo-2-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 46738078 |
| Molecular Formula | C8H4BrF5 |
| Molecular Weight | 275.01 g/mol |
| Exact Mass | 273.94 |
| IUPAC Name | 1-bromo-2-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | FC(F)(F)C(F)(F)c1ccccc1Br |
| InChI | InChI=1S/C8H4BrF5/c9-6-4-2-1-3-5(6)7(10,11)8(12,13)14/h1-4H |
| InChIKey | OLKGHFZDSFJNBZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.01 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|