C15H29ClN2O4 — CID 46738164
tert-butyl 4-(1-amino-3-ethoxy-3-oxopropyl)piperidine-1-carboxylate;hydrochloride (PubChem CID 46738164) has the molecular formula C15H29ClN2O4 and a molecular weight of 336.86 g/mol. Its IUPAC name is tert-butyl 4-(1-amino-3-ethoxy-3-oxopropyl)piperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 4-(1-amino-3-ethoxy-3-oxopropyl)piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 46738164 |
| Molecular Formula | C15H29ClN2O4 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl 4-(1-amino-3-ethoxy-3-oxopropyl)piperidine-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)CC(N)C1CCN(C(=O)OC(C)(C)C)CC1.Cl |
| InChI | InChI=1S/C15H28N2O4.ClH/c1-5-20-13(18)10-12(16)11-6-8-17(9-7-11)14(19)21-15(2,3)4;/h11-12H,5-10,16H2,1-4H3;1H |
| InChIKey | YCHHVBZJGIBZHT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |