About 3-chloro-4-hexylfuran-2,5-dione
3-chloro-4-hexylfuran-2,5-dione (PubChem CID 46738636) has the molecular formula C10H13ClO3
and a molecular weight of 216.66 g/mol. Its IUPAC name is 3-chloro-4-hexylfuran-2,5-dione.
Molecular Properties
| Compound Name | 3-chloro-4-hexylfuran-2,5-dione |
| PubChem CID | 46738636 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3-chloro-4-hexylfuran-2,5-dione |
| SMILES | CCCCCCC1=C(Cl)C(=O)OC1=O |
| InChI | InChI=1S/C10H13ClO3/c1-2-3-4-5-6-7-8(11)10(13)14-9(7)12/h2-6H2,1H3 |
| InChIKey | PBQWSSKXJGRBTP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-hexylfuran-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-hexylfuran-2,5-dione?
The IUPAC name of 3-chloro-4-hexylfuran-2,5-dione (CID 46738636) is 3-chloro-4-hexylfuran-2,5-dione.
What is the SMILES notation for 3-chloro-4-hexylfuran-2,5-dione?
The canonical SMILES for 3-chloro-4-hexylfuran-2,5-dione is CCCCCCC1=C(Cl)C(=O)OC1=O.
What is the InChIKey of 3-chloro-4-hexylfuran-2,5-dione?
The InChIKey is PBQWSSKXJGRBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO3/c1-2-3-4-5-6-7-8(11)10(13)14-9(7)12/h2-6H2,1H3.
What are the key properties of 3-chloro-4-hexylfuran-2,5-dione?
3-chloro-4-hexylfuran-2,5-dione has a molecular weight of 216.66 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-hexylfuran-2,5-dione is sourced from PubChem (CID 46738636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).