C15H24BNO4 — CID 46739108
tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate (PubChem CID 46739108) has the molecular formula C15H24BNO4 and a molecular weight of 293.17 g/mol. Its IUPAC name is tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 46739108 |
| Molecular Formula | C15H24BNO4 |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H24BNO4/c1-13(2,3)19-12(18)17-10-8-9-11(17)16-20-14(4,5)15(6,7)21-16/h8-10H,1-7H3 |
| InChIKey | DZQURIUJAGTAFW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|