C16H24BNO2 — CID 46739236
N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine (PubChem CID 46739236) has the molecular formula C16H24BNO2 and a molecular weight of 273.19 g/mol. Its IUPAC name is N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 46739236 |
| Molecular Formula | C16H24BNO2 |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine |
| SMILES | CC1(C)OB(c2ccccc2CNC2CC2)OC1(C)C |
| InChI | InChI=1S/C16H24BNO2/c1-15(2)16(3,4)20-17(19-15)14-8-6-5-7-12(14)11-18-13-9-10-13/h5-8,13,18H,9-11H2,1-4H3 |
| InChIKey | ZEYXACFFLQISAL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|