C16H26BNO2S — CID 46739745
1-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]piperidine (PubChem CID 46739745) has the molecular formula C16H26BNO2S and a molecular weight of 307.27 g/mol. Its IUPAC name is 1-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]piperidine.
| Compound Name | 1-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]piperidine |
|---|---|
| PubChem CID | 46739745 |
| Molecular Formula | C16H26BNO2S |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]piperidine |
| SMILES | CC1(C)OB(c2ccc(CN3CCCCC3)s2)OC1(C)C |
| InChI | InChI=1S/C16H26BNO2S/c1-15(2)16(3,4)20-17(19-15)14-9-8-13(21-14)12-18-10-6-5-7-11-18/h8-9H,5-7,10-12H2,1-4H3 |
| InChIKey | KDPVLCCGXRCQCV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|