About 2-oxoindole-5-carboxylic acid
2-oxoindole-5-carboxylic acid (PubChem CID 46739852) has the molecular formula C9H5NO3
and a molecular weight of 175.14 g/mol. Its IUPAC name is 2-oxoindole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-oxoindole-5-carboxylic acid |
| PubChem CID | 46739852 |
| Molecular Formula | C9H5NO3 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 2-oxoindole-5-carboxylic acid |
| SMILES | O=C1C=c2cc(C(=O)O)ccc2=N1 |
| InChI | InChI=1S/C9H5NO3/c11-8-4-6-3-5(9(12)13)1-2-7(6)10-8/h1-4H,(H,12,13) |
| InChIKey | SWEJLWZFTXMBCR-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxoindole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoindole-5-carboxylic acid?
The IUPAC name of 2-oxoindole-5-carboxylic acid (CID 46739852) is 2-oxoindole-5-carboxylic acid.
What is the SMILES notation for 2-oxoindole-5-carboxylic acid?
The canonical SMILES for 2-oxoindole-5-carboxylic acid is O=C1C=c2cc(C(=O)O)ccc2=N1.
What is the InChIKey of 2-oxoindole-5-carboxylic acid?
The InChIKey is SWEJLWZFTXMBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO3/c11-8-4-6-3-5(9(12)13)1-2-7(6)10-8/h1-4H,(H,12,13).
What are the key properties of 2-oxoindole-5-carboxylic acid?
2-oxoindole-5-carboxylic acid has a molecular weight of 175.14 g/mol, XLogP of -0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoindole-5-carboxylic acid is sourced from PubChem (CID 46739852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).