About 7-Fluoroindol-2-one
7-Fluoroindol-2-one (PubChem CID 46739858) has the molecular formula C8H4FNO
and a molecular weight of 149.12 g/mol. Its IUPAC name is 7-fluoroindol-2-one.
Molecular Properties
| Compound Name | 7-Fluoroindol-2-one |
| PubChem CID | 46739858 |
| Molecular Formula | C8H4FNO |
| Molecular Weight | 149.12 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 7-fluoroindol-2-one |
| SMILES | C1=CC2=CC(=O)N=C2C(=C1)F |
| InChI | InChI=1S/C8H4FNO/c9-6-3-1-2-5-4-7(11)10-8(5)6/h1-4H |
| InChIKey | NJCBOQOJKUQXJB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 347 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-Fluoroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-Fluoroindol-2-one?
The IUPAC name of 7-Fluoroindol-2-one (CID 46739858) is 7-fluoroindol-2-one.
What is the SMILES notation for 7-Fluoroindol-2-one?
The canonical SMILES for 7-Fluoroindol-2-one is C1=CC2=CC(=O)N=C2C(=C1)F.
What is the InChIKey of 7-Fluoroindol-2-one?
The InChIKey is NJCBOQOJKUQXJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4FNO/c9-6-3-1-2-5-4-7(11)10-8(5)6/h1-4H.
What are the key properties of 7-Fluoroindol-2-one?
7-Fluoroindol-2-one has a molecular weight of 149.12 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-Fluoroindol-2-one is sourced from PubChem (CID 46739858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).