About 6-methoxyindol-2-one
6-methoxyindol-2-one (PubChem CID 46739860) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 6-methoxyindol-2-one.
Molecular Properties
| Compound Name | 6-methoxyindol-2-one |
| PubChem CID | 46739860 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 6-methoxyindol-2-one |
| SMILES | COc1ccc2c(c1)=NC(=O)C=2 |
| InChI | InChI=1S/C9H7NO2/c1-12-7-3-2-6-4-9(11)10-8(6)5-7/h2-5H,1H3 |
| InChIKey | TUOWPPGTJFJUEA-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxyindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyindol-2-one?
The IUPAC name of 6-methoxyindol-2-one (CID 46739860) is 6-methoxyindol-2-one.
What is the SMILES notation for 6-methoxyindol-2-one?
The canonical SMILES for 6-methoxyindol-2-one is COc1ccc2c(c1)=NC(=O)C=2.
What is the InChIKey of 6-methoxyindol-2-one?
The InChIKey is TUOWPPGTJFJUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-12-7-3-2-6-4-9(11)10-8(6)5-7/h2-5H,1H3.
What are the key properties of 6-methoxyindol-2-one?
6-methoxyindol-2-one has a molecular weight of 161.16 g/mol, XLogP of -0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyindol-2-one is sourced from PubChem (CID 46739860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).