C29H30N4O2S — CID 46740938
N-[3-[[(4,6-dimethylpyrimidin-2-yl)amino]-(2-methoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide (PubChem CID 46740938) has the molecular formula C29H30N4O2S and a molecular weight of 498.65 g/mol. Its IUPAC name is N-[3-[[(4,6-dimethylpyrimidin-2-yl)amino]-(2-methoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide.
| Compound Name | N-[3-[[(4,6-dimethylpyrimidin-2-yl)amino]-(2-methoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 46740938 |
| Molecular Formula | C29H30N4O2S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-[3-[[(4,6-dimethylpyrimidin-2-yl)amino]-(2-methoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide |
| SMILES | COc1ccccc1C(Nc1nc(C)cc(C)n1)c1c(NC(=O)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C29H30N4O2S/c1-18-17-19(2)31-29(30-18)32-26(21-13-7-9-15-23(21)35-3)25-22-14-8-10-16-24(22)36-28(25)33-27(34)20-11-5-4-6-12-20/h4-7,9,11-13,15,17,26H,8,10,14,16H2,1-3H3,(H,33,34)(H,30,31,32) |
| InChIKey | NVYDNPSUFSLKHO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |