C11H13NO2 — CID 4674196
7-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 4674196) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 7-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 4674196 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 7-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | COc1ccc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C11H13NO2/c1-14-9-5-6-10-8(7-9)3-2-4-11(13)12-10/h5-7H,2-4H2,1H3,(H,12,13) |
| InChIKey | GZRSCYDBGFKKHY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |