C27H23N3O6S2 — CID 46742288
N-(4-ethoxyphenyl)-2-[(5Z)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 46742288) has the molecular formula C27H23N3O6S2 and a molecular weight of 549.63 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[(5Z)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[(5Z)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 46742288 |
| Molecular Formula | C27H23N3O6S2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[(5Z)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C\c3ccc(Sc4ccc(C)cc4)c([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C27H23N3O6S2/c1-3-36-20-9-7-19(8-10-20)28-25(31)16-29-26(32)24(38-27(29)33)15-18-6-13-23(22(14-18)30(34)35)37-21-11-4-17(2)5-12-21/h4-15H,3,16H2,1-2H3,(H,28,31)/b24-15- |
| InChIKey | AEFWZKKDCRGBJO-IWIPYMOSSA-N |
| XLogP | 6.13 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|