C15H22ClN3O2 — CID 46743248
ethyl 6-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride (PubChem CID 46743248) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is ethyl 6-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 6-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 46743248 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | ethyl 6-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(N2C3CCC2CC(N)C3)nc1.Cl |
| InChI | InChI=1S/C15H21N3O2.ClH/c1-2-20-15(19)10-3-6-14(17-9-10)18-12-4-5-13(18)8-11(16)7-12;/h3,6,9,11-13H,2,4-5,7-8,16H2,1H3;1H |
| InChIKey | OQJFNUHOKHSECM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |