C13H8ClNO5 — CID 4674347
2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 4674347) has the molecular formula C13H8ClNO5 and a molecular weight of 293.66 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 4674347 |
| Molecular Formula | C13H8ClNO5 |
| Molecular Weight | 293.66 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(=O)[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H8ClNO5/c14-7-3-1-6(2-4-7)10-8(12(17)18)5-9(13(19)20)11(16)15-10/h1-5H,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | RXZSSSWIYCAJRY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.66 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |