2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid

C13H8ClNO5 — CID 4674347

IUPAC2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)c(=O)[nH]c1-c1ccc(Cl)cc1
InChIInChI=1S/C13H8ClNO5/c14-7-3-1-6(2-4-7)10-8(12(17)18)5-9(13(19)20)11(16)15-10/h1-5H,(H,15,16)(H,17,18)(H,19,20)
InChIKeyRXZSSSWIYCAJRY-UHFFFAOYSA-N
MW293.66 g/mol
LogP2.09
Rot. Bonds3

About 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid

2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 4674347) has the molecular formula C13H8ClNO5 and a molecular weight of 293.66 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.

Molecular Properties

Compound Name2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid
PubChem CID4674347
Molecular FormulaC13H8ClNO5
Molecular Weight293.66 g/mol
Exact Mass293.01
IUPAC Name2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)c(=O)[nH]c1-c1ccc(Cl)cc1
InChIInChI=1S/C13H8ClNO5/c14-7-3-1-6(2-4-7)10-8(12(17)18)5-9(13(19)20)11(16)15-10/h1-5H,(H,15,16)(H,17,18)(H,19,20)
InChIKeyRXZSSSWIYCAJRY-UHFFFAOYSA-N
XLogP2.09
TPSA107.46 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.66
LogP ≤ 52.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The IUPAC name of 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (CID 4674347) is 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid is O=C(O)c1cc(C(=O)O)c(=O)[nH]c1-c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The InChIKey is RXZSSSWIYCAJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO5/c14-7-3-1-6(2-4-7)10-8(12(17)18)5-9(13(19)20)11(16)15-10/h1-5H,(H,15,16)(H,17,18)(H,19,20).
What are the key properties of 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid has a molecular weight of 293.66 g/mol, XLogP of 2.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 4674347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).