About 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride
3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride (PubChem CID 46743491) has the molecular formula C9H16ClN3O3S
and a molecular weight of 281.76 g/mol. Its IUPAC name is 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride |
| PubChem CID | 46743491 |
| Molecular Formula | C9H16ClN3O3S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCNCC1.Cl |
| InChI | InChI=1S/C9H15N3O3S.ClH/c1-7-9(8(2)15-11-7)16(13,14)12-5-3-10-4-6-12;/h10H,3-6H2,1-2H3;1H |
| InChIKey | WGFHCNAPSCMSCF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride?
The IUPAC name of 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride (CID 46743491) is 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride.
What is the SMILES notation for 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride?
The canonical SMILES for 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride is Cc1noc(C)c1S(=O)(=O)N1CCNCC1.Cl.
What is the InChIKey of 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride?
The InChIKey is WGFHCNAPSCMSCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3S.ClH/c1-7-9(8(2)15-11-7)16(13,14)12-5-3-10-4-6-12;/h10H,3-6H2,1-2H3;1H.
What are the key properties of 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride?
3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride has a molecular weight of 281.76 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride is sourced from PubChem (CID 46743491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).