C21H16BrN3O — CID 4674430
4-bromo-2-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenol (PubChem CID 4674430) has the molecular formula C21H16BrN3O and a molecular weight of 406.28 g/mol. Its IUPAC name is 4-bromo-2-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenol.
| Compound Name | 4-bromo-2-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenol |
|---|---|
| PubChem CID | 4674430 |
| Molecular Formula | C21H16BrN3O |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 4-bromo-2-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenol |
| SMILES | Oc1ccc(Br)cc1C1N=C(c2ccccc2)NC(c2ccccc2)=N1 |
| InChI | InChI=1S/C21H16BrN3O/c22-16-11-12-18(26)17(13-16)21-24-19(14-7-3-1-4-8-14)23-20(25-21)15-9-5-2-6-10-15/h1-13,21,26H,(H,23,24,25) |
| InChIKey | MZZWSGIAXKKRMW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|