C15H16N2O2 — CID 4674621
4-(2-methylphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 4674621) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-(2-methylphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | 4-(2-methylphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 4674621 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-(2-methylphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | Cc1ccccc1C1NC(=O)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C15H16N2O2/c1-9-5-2-3-6-10(9)14-13-11(16-15(19)17-14)7-4-8-12(13)18/h2-3,5-6,14H,4,7-8H2,1H3,(H2,16,17,19) |
| InChIKey | WUVJZIGJCHMSAD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |