C26H26N4O4 — CID 4674929
1-N,4-N-bis[(4-ethoxyphenyl)methylideneamino]benzene-1,4-dicarboxamide (PubChem CID 4674929) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-N,4-N-bis[(4-ethoxyphenyl)methylideneamino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(4-ethoxyphenyl)methylideneamino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4674929 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-N,4-N-bis[(4-ethoxyphenyl)methylideneamino]benzene-1,4-dicarboxamide |
| SMILES | CCOc1ccc(C=NNC(=O)c2ccc(C(=O)NN=Cc3ccc(OCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O4/c1-3-33-23-13-5-19(6-14-23)17-27-29-25(31)21-9-11-22(12-10-21)26(32)30-28-18-20-7-15-24(16-8-20)34-4-2/h5-18H,3-4H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | LDWAVIXGFBUONJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|