C22H28F8N2O2 — CID 4674934
N,N'-bis[2-(cyclohexen-1-yl)ethyl]-2,2,3,3,4,4,5,5-octafluorohexanediamide (PubChem CID 4674934) has the molecular formula C22H28F8N2O2 and a molecular weight of 504.46 g/mol. Its IUPAC name is N,N'-bis[2-(cyclohexen-1-yl)ethyl]-2,2,3,3,4,4,5,5-octafluorohexanediamide.
| Compound Name | N,N'-bis[2-(cyclohexen-1-yl)ethyl]-2,2,3,3,4,4,5,5-octafluorohexanediamide |
|---|---|
| PubChem CID | 4674934 |
| Molecular Formula | C22H28F8N2O2 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N,N'-bis[2-(cyclohexen-1-yl)ethyl]-2,2,3,3,4,4,5,5-octafluorohexanediamide |
| SMILES | O=C(NCCC1=CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C22H28F8N2O2/c23-19(24,17(33)31-13-11-15-7-3-1-4-8-15)21(27,28)22(29,30)20(25,26)18(34)32-14-12-16-9-5-2-6-10-16/h7,9H,1-6,8,10-14H2,(H,31,33)(H,32,34) |
| InChIKey | QVYPZUPMELVGHD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|