C24H26N6O4S — CID 46752008
2-[[4-methyl-5-[1-(3-methylbenzoyl)pyrrolidin-2-yl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 46752008) has the molecular formula C24H26N6O4S and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-[[4-methyl-5-[1-(3-methylbenzoyl)pyrrolidin-2-yl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-methyl-5-[1-(3-methylbenzoyl)pyrrolidin-2-yl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 46752008 |
| Molecular Formula | C24H26N6O4S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2-[[4-methyl-5-[1-(3-methylbenzoyl)pyrrolidin-2-yl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cccc(C(=O)N2CCCC2c2nnc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3C)n2C)c1 |
| InChI | InChI=1S/C24H26N6O4S/c1-15-6-4-7-17(12-15)23(32)29-11-5-8-20(29)22-26-27-24(28(22)3)35-14-21(31)25-19-10-9-18(30(33)34)13-16(19)2/h4,6-7,9-10,12-13,20H,5,8,11,14H2,1-3H3,(H,25,31) |
| InChIKey | UCCIPEFGSQIFJH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|