C26H28ClN5O2S — CID 46753243
2-[[5-[1-(2-chlorobenzoyl)pyrrolidin-2-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethylphenyl)acetamide (PubChem CID 46753243) has the molecular formula C26H28ClN5O2S and a molecular weight of 510.06 g/mol. Its IUPAC name is 2-[[5-[1-(2-chlorobenzoyl)pyrrolidin-2-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[[5-[1-(2-chlorobenzoyl)pyrrolidin-2-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 46753243 |
| Molecular Formula | C26H28ClN5O2S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-[[5-[1-(2-chlorobenzoyl)pyrrolidin-2-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethylphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(CC)cc2)nnc1C1CCCN1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C26H28ClN5O2S/c1-3-15-32-24(22-10-7-16-31(22)25(34)20-8-5-6-9-21(20)27)29-30-26(32)35-17-23(33)28-19-13-11-18(4-2)12-14-19/h3,5-6,8-9,11-14,22H,1,4,7,10,15-17H2,2H3,(H,28,33) |
| InChIKey | VAUOENKCAPLQQH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|