C22H22ClN5O4S — CID 4675401
N-[1-[[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-methyl-3-nitrobenzamide (PubChem CID 4675401) has the molecular formula C22H22ClN5O4S and a molecular weight of 487.97 g/mol. Its IUPAC name is N-[1-[[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[1-[[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4675401 |
| Molecular Formula | C22H22ClN5O4S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-[1-[[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-methyl-3-nitrobenzamide |
| SMILES | CCC(C)C(NC(=O)c1ccc(C)c([N+](=O)[O-])c1)C(=O)Nc1nnc(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C22H22ClN5O4S/c1-4-12(2)18(24-19(29)14-9-8-13(3)17(11-14)28(31)32)20(30)25-22-27-26-21(33-22)15-6-5-7-16(23)10-15/h5-12,18H,4H2,1-3H3,(H,24,29)(H,25,27,30) |
| InChIKey | JDKGURTZAKTKMR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|