C28H30N2O6 — CID 4675772
[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methyl-2-[(4-methylbenzoyl)amino]butanoate (PubChem CID 4675772) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methyl-2-[(4-methylbenzoyl)amino]butanoate.
| Compound Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methyl-2-[(4-methylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 4675772 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methyl-2-[(4-methylbenzoyl)amino]butanoate |
| SMILES | Cc1ccc(C(=O)NC(C(=O)OCC(=O)c2cc(C)n(-c3ccc4c(c3)OCO4)c2C)C(C)C)cc1 |
| InChI | InChI=1S/C28H30N2O6/c1-16(2)26(29-27(32)20-8-6-17(3)7-9-20)28(33)34-14-23(31)22-12-18(4)30(19(22)5)21-10-11-24-25(13-21)36-15-35-24/h6-13,16,26H,14-15H2,1-5H3,(H,29,32) |
| InChIKey | WSZPTFISYPNNHH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|