C19H21N3O2S — CID 46760826
2-methyl-N-[[2-methyl-3-(propanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 46760826) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-methyl-N-[[2-methyl-3-(propanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-methyl-N-[[2-methyl-3-(propanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 46760826 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-methyl-N-[[2-methyl-3-(propanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(=O)Nc1cccc(NC(=S)NC(=O)c2ccccc2C)c1C |
| InChI | InChI=1S/C19H21N3O2S/c1-4-17(23)20-15-10-7-11-16(13(15)3)21-19(25)22-18(24)14-9-6-5-8-12(14)2/h5-11H,4H2,1-3H3,(H,20,23)(H2,21,22,24,25) |
| InChIKey | CVGUYPXMHDZGCV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|