C16H14N4O6 — CID 46761797
N-[3-[acetyl(methyl)amino]phenyl]-3,5-dinitrobenzamide (PubChem CID 46761797) has the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. Its IUPAC name is N-[3-[acetyl(methyl)amino]phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[3-[acetyl(methyl)amino]phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 46761797 |
| Molecular Formula | C16H14N4O6 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-[3-[acetyl(methyl)amino]phenyl]-3,5-dinitrobenzamide |
| SMILES | CC(=O)N(C)c1cccc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C16H14N4O6/c1-10(21)18(2)13-5-3-4-12(8-13)17-16(22)11-6-14(19(23)24)9-15(7-11)20(25)26/h3-9H,1-2H3,(H,17,22) |
| InChIKey | HSWHPHNVWCHPMB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|