C14H7F4N3S — CID 4676258
[(1,2,3,4-tetrafluorofluoren-9-ylidene)amino]thiourea (PubChem CID 4676258) has the molecular formula C14H7F4N3S and a molecular weight of 325.29 g/mol. Its IUPAC name is [(1,2,3,4-tetrafluorofluoren-9-ylidene)amino]thiourea.
| Compound Name | [(1,2,3,4-tetrafluorofluoren-9-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 4676258 |
| Molecular Formula | C14H7F4N3S |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | [(1,2,3,4-tetrafluorofluoren-9-ylidene)amino]thiourea |
| SMILES | NC(=S)NN=C1c2ccccc2-c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C14H7F4N3S/c15-9-7-5-3-1-2-4-6(5)13(20-21-14(19)22)8(7)10(16)12(18)11(9)17/h1-4H,(H3,19,21,22) |
| InChIKey | GVQGBSJWHBZGID-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|