C24H25NO2 — CID 46763830
N-[1-(4-methoxyphenyl)ethyl]-2-(2-phenylethyl)benzamide (PubChem CID 46763830) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)ethyl]-2-(2-phenylethyl)benzamide.
| Compound Name | N-[1-(4-methoxyphenyl)ethyl]-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 46763830 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-[1-(4-methoxyphenyl)ethyl]-2-(2-phenylethyl)benzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2ccccc2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO2/c1-18(20-14-16-22(27-2)17-15-20)25-24(26)23-11-7-6-10-21(23)13-12-19-8-4-3-5-9-19/h3-11,14-18H,12-13H2,1-2H3,(H,25,26) |
| InChIKey | JQAYQFQPHICUBS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |