C20H24BrNO2 — CID 46764494
2-(2-bromo-4-ethylphenoxy)-N-[1-(4-methylphenyl)propyl]acetamide (PubChem CID 46764494) has the molecular formula C20H24BrNO2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 2-(2-bromo-4-ethylphenoxy)-N-[1-(4-methylphenyl)propyl]acetamide.
| Compound Name | 2-(2-bromo-4-ethylphenoxy)-N-[1-(4-methylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 46764494 |
| Molecular Formula | C20H24BrNO2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-(2-bromo-4-ethylphenoxy)-N-[1-(4-methylphenyl)propyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)NC(CC)c2ccc(C)cc2)c(Br)c1 |
| InChI | InChI=1S/C20H24BrNO2/c1-4-15-8-11-19(17(21)12-15)24-13-20(23)22-18(5-2)16-9-6-14(3)7-10-16/h6-12,18H,4-5,13H2,1-3H3,(H,22,23) |
| InChIKey | OEMCRKCUXXZKHV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |