C41H36ClN3O6 — CID 4676695
2-(3-chloro-4-methylphenyl)-6-(2-hydroxy-4-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4676695) has the molecular formula C41H36ClN3O6 and a molecular weight of 702.21 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-6-(2-hydroxy-4-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(3-chloro-4-methylphenyl)-6-(2-hydroxy-4-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4676695 |
| Molecular Formula | C41H36ClN3O6 |
| Molecular Weight | 702.21 g/mol |
| Exact Mass | 701.23 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-6-(2-hydroxy-4-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5ccc(C)c(Cl)c5)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C41H36ClN3O6/c1-22-9-12-25(13-10-22)43-45-38(48)32-21-31-28(17-18-30-35(31)39(49)44(37(30)47)26-14-11-23(2)33(42)19-26)36(29-16-15-27(51-3)20-34(29)46)41(32,40(45)50)24-7-5-4-6-8-24/h4-17,19-20,30-32,35-36,43,46H,18,21H2,1-3H3 |
| InChIKey | YVFXCCOQIHZFIS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.21 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|