C26H29N3O3S — CID 46767206
4-[(4-methylphenyl)sulfonylamino]-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 46767206) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfonylamino]-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 4-[(4-methylphenyl)sulfonylamino]-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 46767206 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-[(4-methylphenyl)sulfonylamino]-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NCc3ccc(CN4CCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O3S/c1-20-4-14-25(15-5-20)33(31,32)28-24-12-10-23(11-13-24)26(30)27-18-21-6-8-22(9-7-21)19-29-16-2-3-17-29/h4-15,28H,2-3,16-19H2,1H3,(H,27,30) |
| InChIKey | WNVFGTKJIRDPKT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |