C16H15Cl2NO4S — CID 46770198
ethyl 2-chloro-5-[(3-chlorophenyl)methylsulfonylamino]benzoate (PubChem CID 46770198) has the molecular formula C16H15Cl2NO4S and a molecular weight of 388.27 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(3-chlorophenyl)methylsulfonylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[(3-chlorophenyl)methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 46770198 |
| Molecular Formula | C16H15Cl2NO4S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | ethyl 2-chloro-5-[(3-chlorophenyl)methylsulfonylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NS(=O)(=O)Cc2cccc(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C16H15Cl2NO4S/c1-2-23-16(20)14-9-13(6-7-15(14)18)19-24(21,22)10-11-4-3-5-12(17)8-11/h3-9,19H,2,10H2,1H3 |
| InChIKey | BUSRPUJTOQSEMC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |