C25H23BrClF3N4O5S — CID 4677099
diethyl 5-[[5-(4-bromophenyl)-3-chloro-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4677099) has the molecular formula C25H23BrClF3N4O5S and a molecular weight of 663.90 g/mol. Its IUPAC name is diethyl 5-[[5-(4-bromophenyl)-3-chloro-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[5-(4-bromophenyl)-3-chloro-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4677099 |
| Molecular Formula | C25H23BrClF3N4O5S |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 662.02 |
| IUPAC Name | diethyl 5-[[5-(4-bromophenyl)-3-chloro-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2nn3c(c2Cl)NC(c2ccc(Br)cc2)CC3C(F)(F)F)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C25H23BrClF3N4O5S/c1-4-38-23(36)16-11(3)19(24(37)39-5-2)40-22(16)32-21(35)18-17(27)20-31-14(12-6-8-13(26)9-7-12)10-15(25(28,29)30)34(20)33-18/h6-9,14-15,31H,4-5,10H2,1-3H3,(H,32,35) |
| InChIKey | SZKHMKSSOHCFGQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |