C26H30ClN3O3S — CID 4677133
N-[4-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylsulfamoyl]phenyl]acetamide (PubChem CID 4677133) has the molecular formula C26H30ClN3O3S and a molecular weight of 500.06 g/mol. Its IUPAC name is N-[4-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4677133 |
| Molecular Formula | C26H30ClN3O3S |
| Molecular Weight | 500.06 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[4-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(Cc2cccn2Cc2ccccc2Cl)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H30ClN3O3S/c1-20(31)28-22-13-15-25(16-14-22)34(32,33)30(23-9-3-2-4-10-23)19-24-11-7-17-29(24)18-21-8-5-6-12-26(21)27/h5-8,11-17,23H,2-4,9-10,18-19H2,1H3,(H,28,31) |
| InChIKey | GVJDDZFGUXZLHJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.06 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |