C20H19Cl3N4O3S — CID 46772194
N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 46772194) has the molecular formula C20H19Cl3N4O3S and a molecular weight of 501.82 g/mol. Its IUPAC name is N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 46772194 |
| Molecular Formula | C20H19Cl3N4O3S |
| Molecular Weight | 501.82 g/mol |
| Exact Mass | 500.02 |
| IUPAC Name | N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H19Cl3N4O3S/c1-13-24-7-8-26(13)15-5-3-14(4-6-15)11-25-20(28)12-27(31(2,29)30)19-10-17(22)16(21)9-18(19)23/h3-10H,11-12H2,1-2H3,(H,25,28) |
| InChIKey | QNBFRGZPFQANQX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|