C25H34N2O3 — CID 46773192
1-benzyl-N-[1-(3,4-diethoxyphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 46773192) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-benzyl-N-[1-(3,4-diethoxyphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[1-(3,4-diethoxyphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46773192 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1-benzyl-N-[1-(3,4-diethoxyphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | CCOc1ccc(C(C)NC(=O)C2CCCN(Cc3ccccc3)C2)cc1OCC |
| InChI | InChI=1S/C25H34N2O3/c1-4-29-23-14-13-21(16-24(23)30-5-2)19(3)26-25(28)22-12-9-15-27(18-22)17-20-10-7-6-8-11-20/h6-8,10-11,13-14,16,19,22H,4-5,9,12,15,17-18H2,1-3H3,(H,26,28) |
| InChIKey | ZOLGBTIMGSIZTD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |