About diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol
diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol (PubChem CID 4677347) has the molecular formula C26H27N3OS
and a molecular weight of 429.59 g/mol. Its IUPAC name is diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol |
| PubChem CID | 4677347 |
| Molecular Formula | C26H27N3OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)C1CCN(Cc2cccn2-c2nccs2)CC1 |
| InChI | InChI=1S/C26H27N3OS/c30-26(21-8-3-1-4-9-21,22-10-5-2-6-11-22)23-13-17-28(18-14-23)20-24-12-7-16-29(24)25-27-15-19-31-25/h1-12,15-16,19,23,30H,13-14,17-18,20H2 |
| InChIKey | XPSITNBINBGRSO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol?
The IUPAC name of diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol (CID 4677347) is diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol.
What is the SMILES notation for diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol?
The canonical SMILES for diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol is OC(c1ccccc1)(c1ccccc1)C1CCN(Cc2cccn2-c2nccs2)CC1.
What is the InChIKey of diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol?
The InChIKey is XPSITNBINBGRSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N3OS/c30-26(21-8-3-1-4-9-21,22-10-5-2-6-11-22)23-13-17-28(18-14-23)20-24-12-7-16-29(24)25-27-15-19-31-25/h1-12,15-16,19,23,30H,13-14,17-18,20H2.
What are the key properties of diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol?
diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol has a molecular weight of 429.59 g/mol, XLogP of 5.08, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[1-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]piperidin-4-yl]methanol is sourced from PubChem (CID 4677347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).