C22H27FN2O2 — CID 46774662
N-[(4-ethoxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 46774662) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46774662 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCOc1ccc(CNC(=O)C2CCN(Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27FN2O2/c1-2-27-21-9-5-17(6-10-21)15-24-22(26)19-11-13-25(14-12-19)16-18-3-7-20(23)8-4-18/h3-10,19H,2,11-16H2,1H3,(H,24,26) |
| InChIKey | QYEZAJDQYAEEFL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |