C23H29FN2O2 — CID 46776533
1-[(4-fluorophenyl)methyl]-N-[1-(4-methoxyphenyl)propyl]piperidine-4-carboxamide (PubChem CID 46776533) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-[1-(4-methoxyphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-[1-(4-methoxyphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46776533 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-[1-(4-methoxyphenyl)propyl]piperidine-4-carboxamide |
| SMILES | CCC(NC(=O)C1CCN(Cc2ccc(F)cc2)CC1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H29FN2O2/c1-3-22(18-6-10-21(28-2)11-7-18)25-23(27)19-12-14-26(15-13-19)16-17-4-8-20(24)9-5-17/h4-11,19,22H,3,12-16H2,1-2H3,(H,25,27) |
| InChIKey | DLRRHTBCERKYNK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |