C25H33ClN2O2 — CID 46776614
1-[(2-chlorophenyl)methyl]-N-[1-(4-methoxyphenyl)-3-methylbutyl]piperidine-3-carboxamide (PubChem CID 46776614) has the molecular formula C25H33ClN2O2 and a molecular weight of 429.00 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[1-(4-methoxyphenyl)-3-methylbutyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[1-(4-methoxyphenyl)-3-methylbutyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46776614 |
| Molecular Formula | C25H33ClN2O2 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[1-(4-methoxyphenyl)-3-methylbutyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(C(CC(C)C)NC(=O)C2CCCN(Cc3ccccc3Cl)C2)cc1 |
| InChI | InChI=1S/C25H33ClN2O2/c1-18(2)15-24(19-10-12-22(30-3)13-11-19)27-25(29)21-8-6-14-28(17-21)16-20-7-4-5-9-23(20)26/h4-5,7,9-13,18,21,24H,6,8,14-17H2,1-3H3,(H,27,29) |
| InChIKey | RSIAANWTGKPVES-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |